Information on EC - aryldialkylphosphatase

for references in articles please use BRENDA:EC3.1.8.1
Word Map on EC
Please wait a moment until all data is loaded. This message will disappear when all data is loaded.
Specify your search results
Select one or more organisms in this record:
Show additional data
Do not include text mining results
Include (text mining) results
Include results (AMENDA + additional results, but less precise)

The expected taxonomic range for this enzyme is: Bacteria, Eukaryota, Archaea

GeneOntology No.
an aryl dialkyl phosphate + H2O = dialkyl phosphate + an aryl alcohol
show the reaction diagram
hydrolysis of phosphoric triester
MetaCyc Link
methyl parathion degradation
paraoxon degradation
parathion degradation
degradation of aromatic, nitrogen containing compounds
Aminobenzoate degradation
Microbial metabolism in diverse environments
IUBMB Comments
aryltriphosphate dialkylphosphohydrolase
Acts on organophosphorus compounds (such as paraoxon) including esters of phosphonic and phosphinic acids. Inhibited by chelating agents; requires divalent cations for activity. Previously regarded as identical with EC arylesterase.
Manually annotated by BRENDA team
Manually annotated by BRENDA team
Meles taxus
Manually annotated by BRENDA team
no activity in aves
Manually annotated by BRENDA team
Manually annotated by BRENDA team
tufted apple bud moth, azinphosmethyl-resistant fifth instars
Manually annotated by BRENDA team
Plesiomonas sp.
gene mpd
Manually annotated by BRENDA team
gene mpd
Manually annotated by BRENDA team
gene opd
Manually annotated by BRENDA team
Manually annotated by BRENDA team
Sulfolobus solfataricus MT-4 / DSM 5833
Manually annotated by BRENDA team
Manually annotated by BRENDA team
paraoxonase 1 knockout mice are dramatically more sensitive than wild type mice to the toxicity of chlorpyrifos oxon and diazoxon and to a lesser extent the parent phosphorothioates, chlorpyrifos and diazinon
physiological function
(Substrate) hide
(Product) hide
?=not specified
(+)-cyclosarin + H2O
methyl-phosphonic acid monofluoride + cyclohexanol
show the reaction diagram
1,2,2-trimethylpropylmethylphosphonofluoridate + H2O
show the reaction diagram
1-methylethyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl methylphosphonate + H2O
show the reaction diagram
1-methylethyl 4-methyl-2-oxo-2H-chromen-7-yl methylphosphonate + H2O
show the reaction diagram
1-methylethyl 4-nitrophenyl (1-methylpropyl)phosphonate + H2O
4-nitrophenol + 1-methylethyl hydrogen (1-methylpropyl)phosphonate
show the reaction diagram
1-methylethyl 4-nitrophenyl methylphosphonate + H2O
4-nitrophenol + 1-methylethyl hydrogen methylphosphonate
show the reaction diagram
1-methylpropyl 4-nitrophenyl methylphosphonate + H2O
4-nitrophenol + 1-methylpropyl hydrogen methylphosphonate
show the reaction diagram
1-palmitoyl-2-(5-oxo)valeroyl-sn-glycero-3-phosphocholine + H2O
lysophosphatidylcholine + ?
show the reaction diagram
1-palmitoyl-2-(9-oxo)nonanoyl-sn-glycero-3-phosphocholine + H2O
show the reaction diagram
2,4-dinitrophenyl diethyl phosphate + H2O
2,4-dinitrophenol + diethyl phosphate
show the reaction diagram
2,6-difluorophenyl diethyl phosphate + H2O
2,6-difluorophenol + diethyl phosphate
show the reaction diagram
2-fluoro-4-nitrophenyl diethyl phosphate + H2O
2-fluoro-4-nitrophenol + diethyl phosphate
show the reaction diagram
2-methylpropyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl methylphosphonate + H2O
show the reaction diagram
2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl N,N,N',N'-tetramethyldiamidophosphate + H2O
show the reaction diagram
3,5-dinitrophenyl diethyl phosphate + H2O
3,5-dinitrophenol + diethyl phosphate
show the reaction diagram
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl 1-methylethyl methylphosphonate + H2O
show the reaction diagram
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl 2-methylpropyl methylphosphonate + H2O
show the reaction diagram
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl cyclohexyl methylphosphonate + H2O
show the reaction diagram
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl diethyl phosphate + H2O
show the reaction diagram
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl dimethyl phosphate + H2O
show the reaction diagram
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl ethyl methylphosphonate + H2O
3-chloro-7-hydroxy-4-methyl-2H-chromen-2-one + ethyl methylphosphonate
show the reaction diagram
3-chloro-4-methyl-2-oxo-2H-chromen-7-yl ethyl methylphosphonate + H2O
show the reaction diagram
3-cyanophenyl diethyl phosphate + H2O
3-cyanophenol + diethyl phosphate
show the reaction diagram
3-fluoro-4-nitrophenyl diethyl phosphate + H2O
3-fluoro-4-nitrophenol + diethyl phosphate
show the reaction diagram
3-fluorophenyl diethyl phosphate + H2O
3-fluorophenol + diethyl phosphate
show the reaction diagram
3-nitrophenyl diethyl phosphate + H2O
3-nitrophenol + diethyl phosphate
show the reaction diagram
4-acetylphenyl (2R)-3,3-dimethylbutan-2-yl (R)-methylphosphonate + H2O
4-acetylphenol + (2R)-3,3-dimethylbutan-2-yl (R)-methylphosphonate
show the reaction diagram
4-acetylphenyl (2R)-3,3-dimethylbutan-2-yl (S)-methylphosphonate + H2O
4-acetylphenol + (2R)-3,3-dimethylbutan-2-yl (S)-methylphosphonate
show the reaction diagram
4-acetylphenyl (2S)-3,3-dimethylbutan-2-yl (R)-methylphosphonate + H2O
4-acetylphenol + 4-acetylphenol + (2S)-3,3-dimethylbutan-2-yl (R)-methylphosphonate
show the reaction diagram
4-acetylphenyl (2S)-3,3-dimethylbutan-2-yl (S)-methylphosphonate + H2O
4-acetylphenol + (2S)-3,3-dimethylbutan-2-yl (S)-methylphosphonate
show the reaction diagram
4-acetylphenyl 2-methylpropyl (R)-methylphosphonate + H2O
4-acetylphenol + 2-methylpropyl (R)-methylphosphonate
show the reaction diagram
4-acetylphenyl 2-methylpropyl (S)-methylphosphonate + H2O
4-acetylphenol + 2-methylpropyl (S)-methylphosphonate
show the reaction diagram
4-acetylphenyl cyclohexyl (R)-methylphosphonate + H2O
4-acetylphenol + cyclohexyl (R)-methylphosphonate
show the reaction diagram
4-acetylphenyl cyclohexyl (S)-methylphosphonate + H2O
4-acetylphenol + cyclohexyl (S)-methylphosphonate
show the reaction diagram
4-acetylphenyl ethyl (R)-methylphosphonate + H2O
4-acetylphenol + ethyl (R)-methylphosphonate
show the reaction diagram
4-acetylphenyl ethyl (S)-methylphosphonate + H2O
4-acetylphenol + ethyl (S)-methylphosphonate
show the reaction diagram
4-acetylphenyl propan-2-yl (R)-methylphosphonate + H2O
4-acetylphenol + propan-2-yl (R)-methylphosphonate
show the reaction diagram
4-acetylphenyl propan-2-yl (S)-methylphosphonate + H2O
4-acetylphenol + propan-2-yl (S)-methylphosphonate
show the reaction diagram
4-chlorophenyl diethyl phosphate + H2O
4-chlorophenol + diethyl phosphate
show the reaction diagram
4-cyanophenyl diethyl phosphate + H2O
4-cyanophenol + diethyl phosphate
show the reaction diagram
4-diethyl phosphate acetophenone + H2O
4-hydroxyacetophenone + diethyl phosphate
show the reaction diagram
4-diethyl phosphate benzaldehyde + H2O
4-hydroxybenzaldehyde + diethyl phosphate
show the reaction diagram
4-diethyl phosphate methyl benzoate + H2O
methyl 4-hydroxybenzoate + diethyl phosphate
show the reaction diagram
4-methyl-2-oxo-2H-chromen-7-yl 2-methylpropyl methylphosphonate + H2O
show the reaction diagram
4-methyl-2-oxo-2H-chromen-7-yl N,N,N',N'-tetramethyldiamidophosphate + H2O
show the reaction diagram
4-nitrophenolate + H2O
show the reaction diagram
4-nitrophenyl butanoate + H2O
4-nitrophenol + butanoate
show the reaction diagram
4-nitrophenyl diethyl phosphate + H2O
4-nitrophenol + diethyl phosphate
show the reaction diagram
4-nitrophenyl phenyl methylphosphonate + H2O
4-nitrophenol + phenyl hydrogen methylphosphonate
show the reaction diagram
4-nitrophenyl phenyl methylphosphonate + H2O
phenyl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
wild-type, 78% of the activity with propyl 4-nitrophenyl methylphosphonate
4-nitrophenyl phosphate + H2O
4-nitrophenol + phosphate
show the reaction diagram
4-nitrophenyl propan-2-yl methylphosphonate + H2O
propan-2-yl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
wild-type, 57% of the activity with propyl 4-nitrophenyl methylphosphonate
4-nitrophenyl propyl methylphosphonate + H2O
4-nitrophenol + propyl hydrogen methylphosphonate
show the reaction diagram
7-diethylphospho-6,8-difluor-4-methylumbelliferyl + H2O
diethylphosphate + 6,8-difluor-4-methylumbelliferol
show the reaction diagram
high level of hydrolysis of the fluorogenic substrate, fluorescence assay method optimization
7-diethylphosphoro-3-cyanocoumarin + H2O
3-cyanocoumarin + diethyl phosphate
show the reaction diagram
7-O-diethylphosphoryl-3-cyano-7-hydroxycoumarin + H2O
show the reaction diagram
acephate + H2O
show the reaction diagram
bis(1-methylethyl) 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl phosphate + H2O
show the reaction diagram
bis(1-methylethyl) 4-methyl-2-oxo-2H-chromen-7-yl phosphate + H2O
show the reaction diagram
butan-2-yl 4-nitrophenyl methylphosphonate + H2O
butan-2-yl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
wild-type, 50% of the activity with propyl 4-nitrophenyl methylphosphonate
chlorpyrifos + H2O
3,5,6-trichloro-pyridin-2-ol + diethyl thiophosphate
show the reaction diagram
chlorpyrifos + H2O
show the reaction diagram
chlorpyrifos oxon + H2O
3,5,6-trichloro-pyridin-2-ol + diethyl phosphate
show the reaction diagram
chlorpyrifos oxon + H2O
show the reaction diagram
chlorpyrifos-oxon + H2O
3,5,6-trichloro-2-pyridinol + diethyl phosphate
show the reaction diagram
chlorpyrifos-oxon + H2O
3,5,6-trichloro-pyridin-2-ol + diethyl phosphate
show the reaction diagram
chlorpyrifos-oxon + H2O
show the reaction diagram
chlorpyriphosoxon + H2O
show the reaction diagram
chlortion + H2O
show the reaction diagram
chlorthion is O,O-dimethyl O-(3-chloro-4-nitrophenyl) thionophosphate
CMP-coumarin + H2O
show the reaction diagram
coroxon + H2O
show the reaction diagram
coumaphos + H2O
3-chloro-4-methylumbelliferone + diethyl thiophosphate
show the reaction diagram
coumaphos + H2O
show the reaction diagram
show the reaction diagram
cyclohexyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl methylphosphonate + H2O
show the reaction diagram
cyclohexyl 4-methyl-2-oxo-2H-chromen-7-yl methylphosphonate + H2O
show the reaction diagram
cyclosarin + H2O
show the reaction diagram
cyclosarin + H2O
methyl-phosphonic acid monofluoride + cyclohexanol
show the reaction diagram
demethon-S + H2O
show the reaction diagram
demeton-S + H2O
2-ethylsulfanyl-ethanethiol + diethyl phosphate
show the reaction diagram
demeton-S methyl + H2O
2-ethylsulfanyl-ethanethiol + dimethyl phosphate
show the reaction diagram
demeton-S-methyl + H2O
2-ethylsulfanyl-ethanethiol + dimethyl phosphate
show the reaction diagram
diazinon + H2O
show the reaction diagram
diazoxon + H2O
2-isopropyl-6-methyl-pyrimidin-4-ol + diethyl phosphate
show the reaction diagram
diazoxon + H2O
6-methyl-2-(1-methylethyl)pyrimidin-4-ol + diethyl phosphate
show the reaction diagram
diazoxon + H2O
show the reaction diagram
dichlorvos + H2O
2,2-dichloroethenol + dimethyl hydrogen phosphate
show the reaction diagram
diethyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl phosphate + H2O
show the reaction diagram
diethyl 4-chlorophenyl phosphate + H2O
4-chlorophenol + diethyl phosphate
show the reaction diagram
diethyl 4-chlorophenyl thiophosphate + H2O
4-chlorophenol + diethyl thiophosphate
show the reaction diagram
diethyl 4-methylbenzylphosphonate + H2O
show the reaction diagram
diethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + diethyl hydrogen phosphate
show the reaction diagram
diethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + diethyl phosphate
show the reaction diagram
diethyl paraoxon + H2O
show the reaction diagram
diisopropyl fluorophosphate + H2O
show the reaction diagram
diisopropyl fluorophosphate + H2O
isopropanol + ?
show the reaction diagram
diisopropylfluorophosphate + H2O
show the reaction diagram
dimefox + H2O
show the reaction diagram
dimethoate + H2O
show the reaction diagram
dimethyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl phosphate + H2O
show the reaction diagram
dimethyl 4-methyl-2-oxo-2H-chromen-7-yl phosphate + H2O
show the reaction diagram
dimethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + dimethyl hydrogen phosphate
show the reaction diagram
13.3% relative specific activity compared to methyl 1-methylethyl 4-nitrophenyl phosphate
dimethyl paraoxon + H2O
show the reaction diagram
ethyl 1-methylethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + ethyl 1-methylethyl hydrogen phosphate
show the reaction diagram
ethyl 2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl methylphosphonate + H2O
show the reaction diagram
ethyl 4-methyl-2-oxo-2H-chromen-7-yl methylphosphonate + H2O
show the reaction diagram
ethyl 4-nitrophenyl (1-methylpropyl)phosphonate + H2O
4-nitrophenol + ethyl hydrogen (1-methylpropyl)phosphonate
show the reaction diagram
ethyl 4-nitrophenyl methylphosphonate + H2O
4-nitrophenol + ethyl hydrogen methylphosphonate
show the reaction diagram
ethyl 4-nitrophenyl methylphosphonate + H2O
ethyl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
wild-type, 50% of the activity with propyl 4-nitrophenyl methylphosphonate
ethyl paraoxon + H2O
4-nitrophenol + diethyl phosphate
show the reaction diagram
ethyl paraoxon + H2O
show the reaction diagram
ethyl parathion + H2O
show the reaction diagram
ethyl phenyl parathion
show the reaction diagram
ethyl-paraoxon + H2O
show the reaction diagram
fenitroxon + H2O
show the reaction diagram
fensulfothion + H2O
show the reaction diagram
isopropyl methylphosphonofluoridate + H2O
show the reaction diagram
malathion + H2O
2-nitro-5-thiobenzoate + ?
show the reaction diagram
malathion + H2O
show the reaction diagram
malathion + H2O
malic acid diethylester + O,O-dimethyl dithiophosphate
show the reaction diagram
methyl 1-methylethyl 4-nitrophenyl phosphate + H2O
4-nitrophenol + methyl 1-methylethyl hydrogen phosphate
show the reaction diagram
100% activity
methyl 4-nitrophenyl methylphosphonate + H2O
methyl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
wild-type, 733% of the activity with propyl 4-nitrophenyl methylphosphonate
methyl chlorpyrifos oxon + H2O
show the reaction diagram
methyl chlorpyrifos thion + H2O
show the reaction diagram
methyl paraoxon + H2O
4-nitrophenol + dimethyl phosphate
show the reaction diagram
methyl paraoxon + H2O
4-nitrophenol + dimethylphosphate
show the reaction diagram
the enzyme reaction also produces two protons, which lower the pH and establish a steady pH gradient
methyl paraoxon + H2O
4-nitrophenol + methyl diethyl phosphate
show the reaction diagram
methyl paraoxon + H2O
show the reaction diagram
methyl parathion + H2O
4-nitrophenol + dimethyl thiophosphate
show the reaction diagram
methyl parathion + H2O
show the reaction diagram
methyl parathion + H2O
methyl diethylthiophosphate + 4-nitrophenol
show the reaction diagram
mono(diethylphosphoryl)obidoxime + H2O
diethyl hydrogenphosphate + obidoxime
show the reaction diagram
substrate is a potent inhibitor of human acetylcholinesterase
N-[2-[ethoxy(methyl)phosphoryl]sulfanethyl]-N-propan-2-ylpropan-2-amine + H2O
S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + ethanol
show the reaction diagram
the enzyme shows only minimal activity against the nerve agent VX
nitrophenyl isopropyl methylphosphonate + H2O
nitrophenol + propan-2-yl hydrogen methylphosphonate
show the reaction diagram
a series of substituted phenoxyalkyl pyridinium oximes enhance the degradation of surrogates of sarin (i.e. nitrophenyl isopropyl methylphosphonate, NIMP) and VX (i.e. nitrophenyl ethyl methylphosphonate, NEMP). Neither NIMP nor NEMP is hydrolyzed effectively by paraoxonase PON1 if one of these oximes is absent. In the presence of eight novel oximes, PON1-mediated degradation of both surrogates occurs
O,O-diisopropyl-4-nitrophenyl phosphate + H2O
dipropan-2-yl hydrogen phosphate + 4-nitrophenol
show the reaction diagram
O,O-dimethyl O-(4-methyl-2-oxo-2H-chromen-7-yl) thiophosphate + H2O
show the reaction diagram
O,O-dimethyl O-[2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl] thiophosphate + H2O
show the reaction diagram
O-ethyl O-4-nitrophenyl phenylphosphonothioate + H2O
show the reaction diagram
O-ethyl S-(2-diisopropylaminoethyl) methylphosphonothioate + H2O
show the reaction diagram
i.e. VX, a highly toxic organophosphorus nerve agent, stereospecific hydrolysis
O-ethyl S-(2-diisopropylaminomethyl)methylphosphonothioate + H2O
show the reaction diagram
also called VX
O-ethyl S-2-diisopropylaminoethyl methylphosphonothiolate + H2O
show the reaction diagram
O-ethyl-S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + H2O
S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + ethanol
show the reaction diagram
hydrolysis is exclusively preferential for the P+ isomer. Glycosylation state of PON1 does not affect substrate stereoselectivity
O-ethyl-S-[2-(diisopropylamino)ethyl]methylphosphonothioate + H2O
S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + ethanol
show the reaction diagram
O-ethyl-S-[2-(diisopropylamino)ethyl]methylphosphonothiate's lone oxygen atom has a strong preference for forming a direct electrostatic interaction with PON1's active site calcium ion. Key residues, which interact with VX are E53, H115, N168, F222, N224, L240, D269, I291, F292, and V346. Residue D183 located in PON1's active site may act as a proton donor or accepter during hydrolysis. PON1's flexible loop region acts as a gatekeeper to the active site residues required for binding VX
O-isobutyl S-(N,N-diethylaminoethyl)methylphosphonothioate + H2O
show the reaction diagram
also called VR
O-isobutyl-S-[2-(diethylamino)ethyl]methylphosphonothioic acid + H2O
show the reaction diagram
hydrolysis is exclusively preferential for the P+ isomer. Glycosylation state of PON1 does not affect substrate stereoselectivity
O-methyl O-(4-nitrophenyl) methylphosphonothioate + H2O
O-methyl-methylphosphonothionic acid + 4-nitrophenol
show the reaction diagram
paraoxon + H2O
4-nitrophenol + di-ethyl phosphate
show the reaction diagram
paraoxon + H2O
4-nitrophenol + diethyl phosphate
show the reaction diagram
paraoxon + H2O
4-nitrophenol + diethylphosphate
show the reaction diagram
paraoxon + H2O
4-nitrophenol + dimethylphosphate
show the reaction diagram
paraoxon + H2O
show the reaction diagram
paraoxon + H2O
diethyl phosphate + 4-nitrophenol
show the reaction diagram
paraoxon + H2O
diethylphosphate + 4-nitrophenol
show the reaction diagram
parathion + H2O
4-nitrophenol + diethyl thiophosphate
show the reaction diagram
parathion + H2O
show the reaction diagram
parathion + H2O
diethylthiophosphate + 4-nitrophenol
show the reaction diagram
pentafluorophenyl diethyl phosphate + H2O
show the reaction diagram
phenyl acetate + H2O
phenol + acetate
show the reaction diagram
phosalone + H2O
show the reaction diagram
phosmet + H2O
N-hydroxymethyl-phthalimide + O,O-dimethyl dithiophosphate
show the reaction diagram
phosphatidylcholine isoprostane + H2O
show the reaction diagram
pirimiphos-methyloxon + H2O
show the reaction diagram
propyl 4-nitrophenyl methylphosphonate + H2O
propyl hydrogen methylphosphonate + 4-nitrophenol
show the reaction diagram
RP-O-ethyl methylphosphonyl-3-cyano-7-hydroxy-4-methylcoumarin + H2O
show the reaction diagram
RP-O-n-propyl methylphosphonyl-3-cyano-7-hydroxy-4-methylcoumarin + H2O
show the reaction diagram
russian VX + H2O
methyl-phosphonothioic acid S-(2-diethylamino-ethyl) ester + 2-methylpropanol
show the reaction diagram
S-(2-[di(propan-2-yl)amino]ethyl)O-ethyl methylphosphonothioate
O-ethyl hydrogen methylphosphonothioate + 2-[di(propan-2-yl)amino]ethanol
show the reaction diagram
i.e. nerve agent VX
sarin + H2O
show the reaction diagram
sarin + H2O
methyl-phosphonic acid monofluoride + isopropyl alcohol
show the reaction diagram
sarin + H2O
methylphosphonofluoride acid + ?
show the reaction diagram
soman + H2O
show the reaction diagram
soman + H2O
methyl-phosphonic acid monofluoride + 1,2,2-trimethylpropanol
show the reaction diagram
soman + H2O
methylphosphonofluoride acid + 3,3-dimethylbutan-2-ol
show the reaction diagram
SP-O-ethyl methylphosphonyl-3-cyano-7-hydroxy-4-methylcoumarin + H2O
show the reaction diagram
SP-O-n-propyl methylphosphonyl-3-cyano-7-hydroxy-4-methylcoumarin + H2O
show the reaction diagram
tabun + H2O
show the reaction diagram
tabun + H2O
cyanophosphonic acid dimethylamide + ethanol
show the reaction diagram
trimethyl phosphate + H2O
show the reaction diagram
VR + H2O
show the reaction diagram
VX + H2O
show the reaction diagram
VX + H2O
S-[2-(diisopropylamino)ethyl]-methylphosphonothioic acid + ethanol
show the reaction diagram
additional information
(Substrate) hide
(Product) hide
?=not specified
additional information
added to optimized fluorescence assay
the enzyme depends on divalent metal ions with Co2+, Mg2+, and Ni2+ being the most effective
additional information